C19H18NO2- — CID 143092593
(Z,3Z)-3-[6-methylidene-3-(1-phenylmethoxyethenyl)cyclohexa-2,4-dien-1-ylidene]-N-oxidoprop-1-en-1-amine (PubChem CID 143092593) has the molecular formula C19H18NO2- and a molecular weight of 292.36 g/mol. Its IUPAC name is (Z,3Z)-3-[6-methylidene-3-(1-phenylmethoxyethenyl)cyclohexa-2,4-dien-1-ylidene]-N-oxidoprop-1-en-1-amine.
| Compound Name | (Z,3Z)-3-[6-methylidene-3-(1-phenylmethoxyethenyl)cyclohexa-2,4-dien-1-ylidene]-N-oxidoprop-1-en-1-amine |
|---|---|
| PubChem CID | 143092593 |
| Molecular Formula | C19H18NO2- |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (Z,3Z)-3-[6-methylidene-3-(1-phenylmethoxyethenyl)cyclohexa-2,4-dien-1-ylidene]-N-oxidoprop-1-en-1-amine |
| SMILES | C=C(OCc1ccccc1)c1ccc(=C)/c(=C\C=C/N[O-])c1 |
| InChI | InChI=1S/C19H18NO2/c1-15-10-11-19(13-18(15)9-6-12-20-21)16(2)22-14-17-7-4-3-5-8-17/h3-13,20H,1-2,14H2/q-1/b12-6-,18-9- |
| InChIKey | XNKYFYVNVHBAPQ-HQCJMGMUSA-N |
| XLogP | 2.67 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|