C14H23NO2 — CID 14309613
(1R,2R,4S,7S)-7-tert-butyl-1,3,3-trimethyl-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 14309613) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (1R,2R,4S,7S)-7-tert-butyl-1,3,3-trimethyl-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
| Compound Name | (1R,2R,4S,7S)-7-tert-butyl-1,3,3-trimethyl-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
|---|---|
| PubChem CID | 14309613 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (1R,2R,4S,7S)-7-tert-butyl-1,3,3-trimethyl-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | CC(C)(C)[C@H]1CO[C@]2(C)[C@@H]3[C@H](C(=O)N12)C3(C)C |
| InChI | InChI=1S/C14H23NO2/c1-12(2,3)8-7-17-14(6)10-9(13(10,4)5)11(16)15(8)14/h8-10H,7H2,1-6H3/t8-,9-,10-,14-/m1/s1 |
| InChIKey | BSYMBESYVSNTRX-NZHONMPCSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |