C8H12N2O2 — CID 143097435
1,6-dimethyl-2-oxo-3,4-dihydropyridine-5-carboxamide (PubChem CID 143097435) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,6-dimethyl-2-oxo-3,4-dihydropyridine-5-carboxamide.
| Compound Name | 1,6-dimethyl-2-oxo-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 143097435 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1,6-dimethyl-2-oxo-3,4-dihydropyridine-5-carboxamide |
| SMILES | CC1=C(C(N)=O)CCC(=O)N1C |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(8(9)12)3-4-7(11)10(5)2/h3-4H2,1-2H3,(H2,9,12) |
| InChIKey | JPFIKWBIWMRQSS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |