C19H26N8 — CID 143097915
8-ethyl-2-N-[(1S,2R)-2-methylcyclohexyl]-4-N-(pyrimidin-5-ylmethyl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine (PubChem CID 143097915) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is 8-ethyl-2-N-[(1S,2R)-2-methylcyclohexyl]-4-N-(pyrimidin-5-ylmethyl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine.
| Compound Name | 8-ethyl-2-N-[(1S,2R)-2-methylcyclohexyl]-4-N-(pyrimidin-5-ylmethyl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
|---|---|
| PubChem CID | 143097915 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 8-ethyl-2-N-[(1S,2R)-2-methylcyclohexyl]-4-N-(pyrimidin-5-ylmethyl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
| SMILES | CCc1cnn2c(NCc3cncnc3)nc(N[C@H]3CCCC[C@H]3C)nc12 |
| InChI | InChI=1S/C19H26N8/c1-3-15-11-23-27-17(15)25-18(24-16-7-5-4-6-13(16)2)26-19(27)22-10-14-8-20-12-21-9-14/h8-9,11-13,16H,3-7,10H2,1-2H3,(H2,22,24,25,26)/t13-,16+/m1/s1 |
| InChIKey | KDROQANHTJTDSQ-CJNGLKHVSA-N |
| XLogP | 3.08 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |