C24H27BN8 — CID 176916867
CID 176916867 (PubChem CID 176916867) has the molecular formula C24H27BN8 and a molecular weight of 438.35 g/mol.
| Compound Name | CID 176916867 |
|---|---|
| PubChem CID | 176916867 |
| Molecular Formula | C24H27BN8 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(-c4ccccn4)cc3)nc(NC3CCCCC3NC)nc12 |
| InChI | InChI=1S/C24H27BN8/c1-26-20-7-2-3-8-21(20)30-23-31-22-18(25)15-29-33(22)24(32-23)28-14-16-9-11-17(12-10-16)19-6-4-5-13-27-19/h4-6,9-13,15,20-21,26H,2-3,7-8,14H2,1H3,(H2,28,30,31,32) |
| InChIKey | UXBZEMZVWPNJPU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|