C25H36N2O2 — CID 143099826
(6R)-6-[[3-[(Z)-but-1-enyl]-2,2,4-trimethyl-1-oxa-8-azaspiro[4.5]dec-3-en-8-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 143099826) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (6R)-6-[[3-[(Z)-but-1-enyl]-2,2,4-trimethyl-1-oxa-8-azaspiro[4.5]dec-3-en-8-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | (6R)-6-[[3-[(Z)-but-1-enyl]-2,2,4-trimethyl-1-oxa-8-azaspiro[4.5]dec-3-en-8-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 143099826 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | (6R)-6-[[3-[(Z)-but-1-enyl]-2,2,4-trimethyl-1-oxa-8-azaspiro[4.5]dec-3-en-8-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | CC/C=C\C1=C(C)C2(CCN(C[C@@H]3Cc4cccnc4C(O)C3)CC2)OC1(C)C |
| InChI | InChI=1S/C25H36N2O2/c1-5-6-9-21-18(2)25(29-24(21,3)4)10-13-27(14-11-25)17-19-15-20-8-7-12-26-23(20)22(28)16-19/h6-9,12,19,22,28H,5,10-11,13-17H2,1-4H3/b9-6-/t19-,22?/m1/s1 |
| InChIKey | CFITUOUQWUJKMQ-CBBLEKBFSA-N |
| XLogP | 4.60 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |