C22H30F3NO4 — CID 143101028
ethane;ethylbenzene;3-[(2S,4E)-2-hydroxy-5-(trifluoromethyl)octa-4,7-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 143101028) has the molecular formula C22H30F3NO4 and a molecular weight of 429.48 g/mol. Its IUPAC name is ethane;ethylbenzene;3-[(2S,4E)-2-hydroxy-5-(trifluoromethyl)octa-4,7-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;ethylbenzene;3-[(2S,4E)-2-hydroxy-5-(trifluoromethyl)octa-4,7-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143101028 |
| Molecular Formula | C22H30F3NO4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | ethane;ethylbenzene;3-[(2S,4E)-2-hydroxy-5-(trifluoromethyl)octa-4,7-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC/C(=C\C[C@H](O)C(=O)N1CCOC1=O)C(F)(F)F.CC.CCc1ccccc1 |
| InChI | InChI=1S/C12H14F3NO4.C8H10.C2H6/c1-2-3-8(12(13,14)15)4-5-9(17)10(18)16-6-7-20-11(16)19;1-2-8-6-4-3-5-7-8;1-2/h2,4,9,17H,1,3,5-7H2;3-7H,2H2,1H3;1-2H3/b8-4+;;/t9-;;/m0../s1 |
| InChIKey | LYWZCBNASLVNTK-OWPFSOMGSA-N |
| XLogP | 5.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|