C31H55N5O6S — CID 143102270
1-(1-cyclopropyl-3,3-dimethyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;1-ethylsulfanyl-1-(methylamino)propan-2-one;N-prop-2-enylformamide (PubChem CID 143102270) has the molecular formula C31H55N5O6S and a molecular weight of 625.88 g/mol. Its IUPAC name is 1-(1-cyclopropyl-3,3-dimethyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;1-ethylsulfanyl-1-(methylamino)propan-2-one;N-prop-2-enylformamide.
| Compound Name | 1-(1-cyclopropyl-3,3-dimethyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;1-ethylsulfanyl-1-(methylamino)propan-2-one;N-prop-2-enylformamide |
|---|---|
| PubChem CID | 143102270 |
| Molecular Formula | C31H55N5O6S |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.39 |
| IUPAC Name | 1-(1-cyclopropyl-3,3-dimethyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;1-ethylsulfanyl-1-(methylamino)propan-2-one;N-prop-2-enylformamide |
| SMILES | C=CCNC=O.CC(C)(C)C(NC(=O)NC(C(=O)N1CCCC1C=O)C(C)(C)C)C(=O)C1CC1.CCSC(NC)C(C)=O |
| InChI | InChI=1S/C21H35N3O4.C6H13NOS.C4H7NO/c1-20(2,3)16(15(26)13-9-10-13)22-19(28)23-17(21(4,5)6)18(27)24-11-7-8-14(24)12-25;1-4-9-6(7-3)5(2)8;1-2-3-5-4-6/h12-14,16-17H,7-11H2,1-6H3,(H2,22,23,28);6-7H,4H2,1-3H3;2,4H,1,3H2,(H,5,6) |
| InChIKey | AVKUTFXZOQGDMT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|