C20H41NO — CID 143102277
ethane;2,2,3,3-tetramethyl-1-(3,3,4,4-tetramethylazepan-1-yl)butan-1-one (PubChem CID 143102277) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is ethane;2,2,3,3-tetramethyl-1-(3,3,4,4-tetramethylazepan-1-yl)butan-1-one.
| Compound Name | ethane;2,2,3,3-tetramethyl-1-(3,3,4,4-tetramethylazepan-1-yl)butan-1-one |
|---|---|
| PubChem CID | 143102277 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | ethane;2,2,3,3-tetramethyl-1-(3,3,4,4-tetramethylazepan-1-yl)butan-1-one |
| SMILES | CC.CC(C)(C)C(C)(C)C(=O)N1CCCC(C)(C)C(C)(C)C1 |
| InChI | InChI=1S/C18H35NO.C2H6/c1-15(2,3)18(8,9)14(20)19-12-10-11-16(4,5)17(6,7)13-19;1-2/h10-13H2,1-9H3;1-2H3 |
| InChIKey | NYCDNNBILMUCFF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |