About 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine
1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine (PubChem CID 143105311) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine.
Molecular Properties
| Compound Name | 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine |
| PubChem CID | 143105311 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine |
| SMILES | CC.CCCCC1(NC)CCC1.Cc1cccnc1 |
| InChI | InChI=1S/C9H19N.C6H7N.C2H6/c1-3-4-6-9(10-2)7-5-8-9;1-6-3-2-4-7-5-6;1-2/h10H,3-8H2,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | QGWGXRSKHBIFGI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine?
The IUPAC name of 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine (CID 143105311) is 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine.
What is the SMILES notation for 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine?
The canonical SMILES for 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine is CC.CCCCC1(NC)CCC1.Cc1cccnc1.
What is the InChIKey of 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine?
The InChIKey is QGWGXRSKHBIFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C6H7N.C2H6/c1-3-4-6-9(10-2)7-5-8-9;1-6-3-2-4-7-5-6;1-2/h10H,3-8H2,1-2H3;2-5H,1H3;1-2H3.
What are the key properties of 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine?
1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine has a molecular weight of 264.46 g/mol, XLogP of 4.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-N-methylcyclobutan-1-amine;ethane;3-methylpyridine is sourced from PubChem (CID 143105311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).