C18H28N2O2 — CID 143107787
N-[3-[[(4S)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]propyl]formamide (PubChem CID 143107787) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[3-[[(4S)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]propyl]formamide.
| Compound Name | N-[3-[[(4S)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]propyl]formamide |
|---|---|
| PubChem CID | 143107787 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-[3-[[(4S)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]propyl]formamide |
| SMILES | CC(C)(C)Cc1ccc2c(c1)[C@@H](NCCCNC=O)CCO2 |
| InChI | InChI=1S/C18H28N2O2/c1-18(2,3)12-14-5-6-17-15(11-14)16(7-10-22-17)20-9-4-8-19-13-21/h5-6,11,13,16,20H,4,7-10,12H2,1-3H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | OOUDPEYLPVHXAA-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|