C10H15NO — CID 143108121
N-ethyl-4-methoxycyclohepta-1,3,6-trien-1-amine (PubChem CID 143108121) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-ethyl-4-methoxycyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-ethyl-4-methoxycyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 143108121 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-ethyl-4-methoxycyclohepta-1,3,6-trien-1-amine |
| SMILES | CCNC1=CC=C(OC)CC=C1 |
| InChI | InChI=1S/C10H15NO/c1-3-11-9-5-4-6-10(12-2)8-7-9/h4-5,7-8,11H,3,6H2,1-2H3 |
| InChIKey | QPAKIWRUOOWZKN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |