C19H26FNO — CID 143108579
8-fluoro-2-methyl-9a-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1,3,4,4a,8,9-hexahydrocyclohepta[c]pyridin-7-one (PubChem CID 143108579) has the molecular formula C19H26FNO and a molecular weight of 303.42 g/mol. Its IUPAC name is 8-fluoro-2-methyl-9a-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1,3,4,4a,8,9-hexahydrocyclohepta[c]pyridin-7-one.
| Compound Name | 8-fluoro-2-methyl-9a-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1,3,4,4a,8,9-hexahydrocyclohepta[c]pyridin-7-one |
|---|---|
| PubChem CID | 143108579 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 8-fluoro-2-methyl-9a-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1,3,4,4a,8,9-hexahydrocyclohepta[c]pyridin-7-one |
| SMILES | C=C(/C=C\C=C/C)CC12CC(F)C(=O)C=CC1CCN(C)C2 |
| InChI | InChI=1S/C19H26FNO/c1-4-5-6-7-15(2)12-19-13-17(20)18(22)9-8-16(19)10-11-21(3)14-19/h4-9,16-17H,2,10-14H2,1,3H3/b5-4-,7-6- |
| InChIKey | QANKDWORAYVGAY-RZSVFLSASA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|