C29H45NO — CID 91220159
4,8-dimethyl-1-(1-propylpiperidin-4-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one (PubChem CID 91220159) has the molecular formula C29H45NO and a molecular weight of 423.69 g/mol. Its IUPAC name is 4,8-dimethyl-1-(1-propylpiperidin-4-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one.
| Compound Name | 4,8-dimethyl-1-(1-propylpiperidin-4-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 91220159 |
| Molecular Formula | C29H45NO |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | 4,8-dimethyl-1-(1-propylpiperidin-4-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one |
| SMILES | CCCN1CCC(CC(=O)C=C(C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C)CC1 |
| InChI | InChI=1S/C29H45NO/c1-7-18-30-19-15-26(16-20-30)22-27(31)21-24(3)11-8-10-23(2)13-14-28-25(4)12-9-17-29(28,5)6/h8,10-11,13-14,21,26H,7,9,12,15-20,22H2,1-6H3 |
| InChIKey | SZNIMWQMFOZKBU-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|