C20H31NO — CID 123398182
(E)-7-(4-hepta-1,3,5-trien-3-ylpiperidin-4-yl)-5-methylhept-2-en-4-one (PubChem CID 123398182) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (E)-7-(4-hepta-1,3,5-trien-3-ylpiperidin-4-yl)-5-methylhept-2-en-4-one.
| Compound Name | (E)-7-(4-hepta-1,3,5-trien-3-ylpiperidin-4-yl)-5-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 123398182 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (E)-7-(4-hepta-1,3,5-trien-3-ylpiperidin-4-yl)-5-methylhept-2-en-4-one |
| SMILES | C=CC(=CC=CC)C1(CCC(C)C(=O)/C=C/C)CCNCC1 |
| InChI | InChI=1S/C20H31NO/c1-5-8-10-18(7-3)20(13-15-21-16-14-20)12-11-17(4)19(22)9-6-2/h5-10,17,21H,3,11-16H2,1-2,4H3/b8-5?,9-6+,18-10? |
| InChIKey | HAJWYMKSCDZTNG-GVQTWVQESA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|