C13H19N3O2 — CID 143109523
tert-butyl N-[2-[(1Z)-buta-1,3-dienyl]-1-methylimidazol-4-yl]carbamate (PubChem CID 143109523) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(1Z)-buta-1,3-dienyl]-1-methylimidazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(1Z)-buta-1,3-dienyl]-1-methylimidazol-4-yl]carbamate |
|---|---|
| PubChem CID | 143109523 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | tert-butyl N-[2-[(1Z)-buta-1,3-dienyl]-1-methylimidazol-4-yl]carbamate |
| SMILES | C=C/C=C\c1nc(NC(=O)OC(C)(C)C)cn1C |
| InChI | InChI=1S/C13H19N3O2/c1-6-7-8-11-14-10(9-16(11)5)15-12(17)18-13(2,3)4/h6-9H,1H2,2-5H3,(H,15,17)/b8-7- |
| InChIKey | IHFLRZSUKPQPMZ-FPLPWBNLSA-N |
| XLogP | 2.97 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|