C10H18N2 — CID 143109925
N'-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-methylmethanediamine (PubChem CID 143109925) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-methylmethanediamine.
| Compound Name | N'-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-methylmethanediamine |
|---|---|
| PubChem CID | 143109925 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-methylmethanediamine |
| SMILES | CN(CN)CCC1=CCCC=C1 |
| InChI | InChI=1S/C10H18N2/c1-12(9-11)8-7-10-5-3-2-4-6-10/h3,5-6H,2,4,7-9,11H2,1H3 |
| InChIKey | DGKKJEMERDKMCP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|