C26H41N3O3S — CID 143112455
ethane;N-[1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]-10,10a-dihydro-4aH-phenothiazine-2-carboxamide (PubChem CID 143112455) has the molecular formula C26H41N3O3S and a molecular weight of 475.70 g/mol. Its IUPAC name is ethane;N-[1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]-10,10a-dihydro-4aH-phenothiazine-2-carboxamide.
| Compound Name | ethane;N-[1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]-10,10a-dihydro-4aH-phenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 143112455 |
| Molecular Formula | C26H41N3O3S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | ethane;N-[1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]-10,10a-dihydro-4aH-phenothiazine-2-carboxamide |
| SMILES | CC.CC.COCCNC(=O)C(CC(C)C)NC(=O)C1=CC2Nc3ccccc3SC2C=C1 |
| InChI | InChI=1S/C22H29N3O3S.2C2H6/c1-14(2)12-18(22(27)23-10-11-28-3)25-21(26)15-8-9-20-17(13-15)24-16-6-4-5-7-19(16)29-20;2*1-2/h4-9,13-14,17-18,20,24H,10-12H2,1-3H3,(H,23,27)(H,25,26);2*1-2H3 |
| InChIKey | LYMMAAUXSUTSLE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|