C22H34N2O4 — CID 67703459
N-[(2S)-4-methyl-1-[2-[(3S)-5-methyl-2-oxohexan-3-yl]oxyethylamino]-1-oxopentan-2-yl]benzamide (PubChem CID 67703459) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-[2-[(3S)-5-methyl-2-oxohexan-3-yl]oxyethylamino]-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S)-4-methyl-1-[2-[(3S)-5-methyl-2-oxohexan-3-yl]oxyethylamino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 67703459 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N-[(2S)-4-methyl-1-[2-[(3S)-5-methyl-2-oxohexan-3-yl]oxyethylamino]-1-oxopentan-2-yl]benzamide |
| SMILES | CC(=O)[C@H](CC(C)C)OCCNC(=O)[C@H](CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34N2O4/c1-15(2)13-19(24-21(26)18-9-7-6-8-10-18)22(27)23-11-12-28-20(17(5)25)14-16(3)4/h6-10,15-16,19-20H,11-14H2,1-5H3,(H,23,27)(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | TYFPGCUIGUYUJX-PMACEKPBSA-N |
| XLogP | 2.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|