C23H23F3N2O5S — CID 143112577
2-methylidenebutanoic acid;(E)-N-[2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]but-2-ene-2-sulfonamide (PubChem CID 143112577) has the molecular formula C23H23F3N2O5S and a molecular weight of 496.51 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;(E)-N-[2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]but-2-ene-2-sulfonamide.
| Compound Name | 2-methylidenebutanoic acid;(E)-N-[2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]but-2-ene-2-sulfonamide |
|---|---|
| PubChem CID | 143112577 |
| Molecular Formula | C23H23F3N2O5S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-methylidenebutanoic acid;(E)-N-[2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]but-2-ene-2-sulfonamide |
| SMILES | C/C=C(\C)S(=O)(=O)Nc1ccc2oc(-c3ccc(C(F)(F)F)cc3)nc2c1.C=C(CC)C(=O)O |
| InChI | InChI=1S/C18H15F3N2O3S.C5H8O2/c1-3-11(2)27(24,25)23-14-8-9-16-15(10-14)22-17(26-16)12-4-6-13(7-5-12)18(19,20)21;1-3-4(2)5(6)7/h3-10,23H,1-2H3;2-3H2,1H3,(H,6,7)/b11-3+; |
| InChIKey | PDYQYPSVSKZCIA-KODGKZAJSA-N |
| XLogP | 6.22 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|