About 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine
1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine (PubChem CID 143114176) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine.
Analyze 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine?
The IUPAC name of 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine (CID 143114176) is 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine?
The canonical SMILES for 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine is CNCC1=CC=CCC1F.
What is the InChIKey of 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine?
The InChIKey is ZAQPSHOHZYBQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-10-6-7-4-2-3-5-8(7)9/h2-4,8,10H,5-6H2,1H3.
What are the key properties of 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine?
1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine has a molecular weight of 141.19 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluorocyclohexa-1,3-dien-1-yl)-N-methylmethanamine is sourced from PubChem (CID 143114176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).