C17H24Cl2N2O3S — CID 143116406
2,4-dichloro-N-[(1S)-1-(1-ethylsulfonyl-4-methylpiperidin-4-yl)ethyl]benzamide (PubChem CID 143116406) has the molecular formula C17H24Cl2N2O3S and a molecular weight of 407.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S)-1-(1-ethylsulfonyl-4-methylpiperidin-4-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S)-1-(1-ethylsulfonyl-4-methylpiperidin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 143116406 |
| Molecular Formula | C17H24Cl2N2O3S |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2,4-dichloro-N-[(1S)-1-(1-ethylsulfonyl-4-methylpiperidin-4-yl)ethyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCC(C)([C@H](C)NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H24Cl2N2O3S/c1-4-25(23,24)21-9-7-17(3,8-10-21)12(2)20-16(22)14-6-5-13(18)11-15(14)19/h5-6,11-12H,4,7-10H2,1-3H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | ALPNKPRFRNKNMJ-LBPRGKRZSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |