C21H26Cl2N4O3S — CID 11634466
2,4-dichloro-N-[1-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide (PubChem CID 11634466) has the molecular formula C21H26Cl2N4O3S and a molecular weight of 485.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 11634466 |
| Molecular Formula | C21H26Cl2N4O3S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2,4-dichloro-N-[1-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide |
| SMILES | CCNS(=O)(=O)N1CCC(c2ccccn2)(C(C)NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C21H26Cl2N4O3S/c1-3-25-31(29,30)27-12-9-21(10-13-27,19-6-4-5-11-24-19)15(2)26-20(28)17-8-7-16(22)14-18(17)23/h4-8,11,14-15,25H,3,9-10,12-13H2,1-2H3,(H,26,28) |
| InChIKey | GQODHKUNBWXITA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |