C21H26Cl2N4O3S — CID 68898898
2,4-dichloro-N-[2-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide (PubChem CID 68898898) has the molecular formula C21H26Cl2N4O3S and a molecular weight of 485.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 68898898 |
| Molecular Formula | C21H26Cl2N4O3S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2,4-dichloro-N-[2-[1-(ethylsulfamoyl)-4-pyridin-2-ylpiperidin-4-yl]ethyl]benzamide |
| SMILES | CCNS(=O)(=O)N1CCC(CCNC(=O)c2ccc(Cl)cc2Cl)(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H26Cl2N4O3S/c1-2-26-31(29,30)27-13-9-21(10-14-27,19-5-3-4-11-24-19)8-12-25-20(28)17-7-6-16(22)15-18(17)23/h3-7,11,15,26H,2,8-10,12-14H2,1H3,(H,25,28) |
| InChIKey | PLPUJOCVLHUXFD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |