C23H25N3O — CID 143116638
1-benzyl-N-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 143116638) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-benzyl-N-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 143116638 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-benzyl-N-[(1R)-1-phenylethyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nn(Cc2ccccc2)c2c1CCCC2)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O/c1-17(19-12-6-3-7-13-19)24-23(27)22-20-14-8-9-15-21(20)26(25-22)16-18-10-4-2-5-11-18/h2-7,10-13,17H,8-9,14-16H2,1H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | SRCGLUWJMIPRAU-QGZVFWFLSA-N |
| XLogP | 4.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |