C14H15N3O — CID 58713629
1-benzyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 58713629) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-benzyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-benzyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58713629 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-benzyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(Cc2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C14H15N3O/c15-14(18)13-11-7-4-8-12(11)17(16-13)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,15,18) |
| InChIKey | VQZBZGSSNLQSCA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |