C25H31N3O3S — CID 163676047
ethyl [(2R,3S)-3-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]sulfanylformate (PubChem CID 163676047) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is ethyl [(2R,3S)-3-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]sulfanylformate.
| Compound Name | ethyl [(2R,3S)-3-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]sulfanylformate |
|---|---|
| PubChem CID | 163676047 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | ethyl [(2R,3S)-3-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl]sulfanylformate |
| SMILES | CCOC(=O)S[C@@H]1C2CCC(C2)[C@@H]1NC(=O)c1nn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C25H31N3O3S/c1-2-31-25(30)32-23-18-13-12-17(14-18)21(23)26-24(29)22-19-10-6-7-11-20(19)28(27-22)15-16-8-4-3-5-9-16/h3-5,8-9,17-18,21,23H,2,6-7,10-15H2,1H3,(H,26,29)/t17?,18?,21-,23+/m0/s1 |
| InChIKey | JGUJHRCLQPXILZ-ZDNGABSWSA-N |
| XLogP | 4.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|