C26H33N3O4 — CID 66647637
[(2S,3R)-3-[(1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl] ethyl carbonate (PubChem CID 66647637) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is [(2S,3R)-3-[(1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl] ethyl carbonate.
| Compound Name | [(2S,3R)-3-[(1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl] ethyl carbonate |
|---|---|
| PubChem CID | 66647637 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | [(2S,3R)-3-[(1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl)amino]-2-bicyclo[2.2.1]heptanyl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H]1C2CCC(C2)[C@H]1NC(=O)c1nn(Cc2ccccc2)c2c1CCCCC2 |
| InChI | InChI=1S/C26H33N3O4/c1-2-32-26(31)33-24-19-14-13-18(15-19)22(24)27-25(30)23-20-11-7-4-8-12-21(20)29(28-23)16-17-9-5-3-6-10-17/h3,5-6,9-10,18-19,22,24H,2,4,7-8,11-16H2,1H3,(H,27,30)/t18?,19?,22-,24+/m1/s1 |
| InChIKey | BSPAAZDKOYYUTB-CZUXCOCKSA-N |
| XLogP | 4.27 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |