C25H27N3O5 — CID 59836320
methyl 2-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 59836320) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 2-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl 2-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 59836320 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | methyl 2-[(1-benzyl-4,5,6,7-tetrahydroindazole-3-carbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)c1nn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C25H27N3O5/c1-33-25(32)19(13-17-11-12-21(29)22(30)14-17)26-24(31)23-18-9-5-6-10-20(18)28(27-23)15-16-7-3-2-4-8-16/h2-4,7-8,11-12,14,19,29-30H,5-6,9-10,13,15H2,1H3,(H,26,31) |
| InChIKey | HXMQHMWEDNPUTR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|