About 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile
5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile (PubChem CID 143117457) has the molecular formula C13H14BNO
and a molecular weight of 211.07 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile |
| PubChem CID | 143117457 |
| Molecular Formula | C13H14BNO |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile |
| SMILES | C=C(OCC)c1ccc2c(c1)CB(C#N)C2 |
| InChI | InChI=1S/C13H14BNO/c1-3-16-10(2)11-4-5-12-7-14(9-15)8-13(12)6-11/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | PFKNFWUUUSLNLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile?
The IUPAC name of 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile (CID 143117457) is 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile.
What is the SMILES notation for 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile?
The canonical SMILES for 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile is C=C(OCC)c1ccc2c(c1)CB(C#N)C2.
What is the InChIKey of 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile?
The InChIKey is PFKNFWUUUSLNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BNO/c1-3-16-10(2)11-4-5-12-7-14(9-15)8-13(12)6-11/h4-6H,2-3,7-8H2,1H3.
What are the key properties of 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile?
5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile has a molecular weight of 211.07 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile is sourced from PubChem (CID 143117457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).