C13H14BNO — CID 143117457
5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile (PubChem CID 143117457) has the molecular formula C13H14BNO and a molecular weight of 211.07 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile.
| Compound Name | 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile |
|---|---|
| PubChem CID | 143117457 |
| Molecular Formula | C13H14BNO |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-(1-ethoxyethenyl)-1,3-dihydro-2-benzoborole-2-carbonitrile |
| SMILES | C=C(OCC)c1ccc2c(c1)CB(C#N)C2 |
| InChI | InChI=1S/C13H14BNO/c1-3-16-10(2)11-4-5-12-7-14(9-15)8-13(12)6-11/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | PFKNFWUUUSLNLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|