C17H23NO3 — CID 169061042
methyl 3-[[5-(1-ethoxyethenyl)-2,3-dihydro-1H-inden-2-yl]amino]propanoate (PubChem CID 169061042) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 3-[[5-(1-ethoxyethenyl)-2,3-dihydro-1H-inden-2-yl]amino]propanoate.
| Compound Name | methyl 3-[[5-(1-ethoxyethenyl)-2,3-dihydro-1H-inden-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 169061042 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl 3-[[5-(1-ethoxyethenyl)-2,3-dihydro-1H-inden-2-yl]amino]propanoate |
| SMILES | C=C(OCC)c1ccc2c(c1)CC(NCCC(=O)OC)C2 |
| InChI | InChI=1S/C17H23NO3/c1-4-21-12(2)13-5-6-14-10-16(11-15(14)9-13)18-8-7-17(19)20-3/h5-6,9,16,18H,2,4,7-8,10-11H2,1,3H3 |
| InChIKey | NSGJYPBCNGOUKQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|