C24H27ClF3N3O2S — CID 143118148
N-[[2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-chlorophenyl]ethylamino]methyl]hydroxylamine (PubChem CID 143118148) has the molecular formula C24H27ClF3N3O2S and a molecular weight of 514.01 g/mol. Its IUPAC name is N-[[2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-chlorophenyl]ethylamino]methyl]hydroxylamine.
| Compound Name | N-[[2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-chlorophenyl]ethylamino]methyl]hydroxylamine |
|---|---|
| PubChem CID | 143118148 |
| Molecular Formula | C24H27ClF3N3O2S |
| Molecular Weight | 514.01 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[[2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-chlorophenyl]ethylamino]methyl]hydroxylamine |
| SMILES | CCCCc1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc(CCNCNO)c(Cl)c1 |
| InChI | InChI=1S/C24H27ClF3N3O2S/c1-2-3-4-21-22(34-23(31-21)17-5-8-18(9-6-17)24(26,27)28)14-33-19-10-7-16(20(25)13-19)11-12-29-15-30-32/h5-10,13,29-30,32H,2-4,11-12,14-15H2,1H3 |
| InChIKey | HFZDFOUOLOUANA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.01 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|