C15H19N3O — CID 143120443
N-butyl-5-(1,2-dihydropyridin-5-yl)pyridine-3-carboxamide (PubChem CID 143120443) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-butyl-5-(1,2-dihydropyridin-5-yl)pyridine-3-carboxamide.
| Compound Name | N-butyl-5-(1,2-dihydropyridin-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143120443 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-butyl-5-(1,2-dihydropyridin-5-yl)pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1cncc(C2=CNCC=C2)c1 |
| InChI | InChI=1S/C15H19N3O/c1-2-3-7-18-15(19)14-8-13(10-17-11-14)12-5-4-6-16-9-12/h4-5,8-11,16H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | HCPGPSDUKFEOLF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|