C22H20N4O — CID 143121892
4-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]phenol (PubChem CID 143121892) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]phenol.
| Compound Name | 4-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]phenol |
|---|---|
| PubChem CID | 143121892 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]phenol |
| SMILES | Cc1cccc(C)c1-c1cc(C)c2nc(Nc3ccc(O)cc3)nnc2c1 |
| InChI | InChI=1S/C22H20N4O/c1-13-5-4-6-14(2)20(13)16-11-15(3)21-19(12-16)25-26-22(24-21)23-17-7-9-18(27)10-8-17/h4-12,27H,1-3H3,(H,23,24,26) |
| InChIKey | CRRCNOYQRZERIH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|