C29H34N6O2S — CID 68980151
3-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 68980151) has the molecular formula C29H34N6O2S and a molecular weight of 530.70 g/mol. Its IUPAC name is 3-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 3-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68980151 |
| Molecular Formula | C29H34N6O2S |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 3-[[7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-yl]amino]-N-(3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1cccc(C)c1-c1cc(C)c2nc(Nc3cccc(S(=O)(=O)NCCCN4CCCC4)c3)nnc2c1 |
| InChI | InChI=1S/C29H34N6O2S/c1-20-9-6-10-21(2)27(20)23-17-22(3)28-26(18-23)33-34-29(32-28)31-24-11-7-12-25(19-24)38(36,37)30-13-8-16-35-14-4-5-15-35/h6-7,9-12,17-19,30H,4-5,8,13-16H2,1-3H3,(H,31,32,34) |
| InChIKey | AYTSMRHSQXNKRS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|