C20H23BN6O2S — CID 89367644
CID 89367644 (PubChem CID 89367644) has the molecular formula C20H23BN6O2S and a molecular weight of 422.32 g/mol.
| Compound Name | CID 89367644 |
|---|---|
| PubChem CID | 89367644 |
| Molecular Formula | C20H23BN6O2S |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc2nnc(Nc3ccc(S(=O)(=O)NCCN4CCCC4)cc3)nc2cc1C |
| InChI | InChI=1S/C20H23BN6O2S/c1-14-12-18-19(13-17(14)21)25-26-20(24-18)23-15-4-6-16(7-5-15)30(28,29)22-8-11-27-9-2-3-10-27/h4-7,12-13,22H,2-3,8-11H2,1H3,(H,23,24,26) |
| InChIKey | JOQZHVSGOGQWJL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|