C27H29N7O5S — CID 59837678
4-[[7-(2,6-dimethylphenyl)-5-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl]amino]-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide (PubChem CID 59837678) has the molecular formula C27H29N7O5S and a molecular weight of 563.64 g/mol. Its IUPAC name is 4-[[7-(2,6-dimethylphenyl)-5-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl]amino]-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-[[7-(2,6-dimethylphenyl)-5-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl]amino]-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59837678 |
| Molecular Formula | C27H29N7O5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 4-[[7-(2,6-dimethylphenyl)-5-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl]amino]-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide |
| SMILES | Cc1cccc(C)c1-c1cc([N+](=O)[O-])c2nc(Nc3ccc(S(=O)(=O)NCCN4CCCC4)cc3)n[n+]([O-])c2c1 |
| InChI | InChI=1S/C27H29N7O5S/c1-18-6-5-7-19(2)25(18)20-16-23-26(24(17-20)34(36)37)30-27(31-33(23)35)29-21-8-10-22(11-9-21)40(38,39)28-12-15-32-13-3-4-14-32/h5-11,16-17,28H,3-4,12-15H2,1-2H3,(H,29,30,31) |
| InChIKey | JTWFQGDMFNGCDW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|