C9H11NO2 — CID 143124819
8-methyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 143124819) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 8-methyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-methyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143124819 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 8-methyl-4a,8a-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CC1=CC=CC2NC(=O)COC12 |
| InChI | InChI=1S/C9H11NO2/c1-6-3-2-4-7-9(6)12-5-8(11)10-7/h2-4,7,9H,5H2,1H3,(H,10,11) |
| InChIKey | ITEJUKVMUCSUTG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |