C8H13N3 — CID 143126435
1,2-dimethylimidazole-4-carbonitrile;ethane (PubChem CID 143126435) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,2-dimethylimidazole-4-carbonitrile;ethane.
| Compound Name | 1,2-dimethylimidazole-4-carbonitrile;ethane |
|---|---|
| PubChem CID | 143126435 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1,2-dimethylimidazole-4-carbonitrile;ethane |
| SMILES | CC.Cc1nc(C#N)cn1C |
| InChI | InChI=1S/C6H7N3.C2H6/c1-5-8-6(3-7)4-9(5)2;1-2/h4H,1-2H3;1-2H3 |
| InChIKey | XISZSQBBSWPOHE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |