About ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile
ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile (PubChem CID 143126442) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile.
Analyze ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile?
The IUPAC name of ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile (CID 143126442) is ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile.
What is the SMILES notation for ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile?
The canonical SMILES for ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile is CC.N#Cc1cnn2ccnc2n1.
What is the InChIKey of ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile?
The InChIKey is CSHMWCRNBYQSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5.C2H6/c7-3-5-4-9-11-2-1-8-6(11)10-5;1-2/h1-2,4H;1-2H3.
What are the key properties of ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile?
ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile has a molecular weight of 175.19 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;imidazo[1,2-b][1,2,4]triazine-3-carbonitrile is sourced from PubChem (CID 143126442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).