About [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile
[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile (PubChem CID 162521908) has the molecular formula C6H3N5
and a molecular weight of 145.12 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile.
Analyze [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile?
The IUPAC name of [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile (CID 162521908) is [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile.
What is the SMILES notation for [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile?
The canonical SMILES for [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile is N#Cc1ccn2ncnc2n1.
What is the InChIKey of [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile?
The InChIKey is MGWXVPIXMXMHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5/c7-3-5-1-2-11-6(10-5)8-4-9-11/h1-2,4H.
What are the key properties of [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile?
[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile has a molecular weight of 145.12 g/mol, XLogP of -0.00, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[1,5-a]pyrimidine-5-carbonitrile is sourced from PubChem (CID 162521908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).