C21H23F3N2O2 — CID 143126998
ethane;4-methyl-2-(oxan-2-yl)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-one (PubChem CID 143126998) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is ethane;4-methyl-2-(oxan-2-yl)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-one.
| Compound Name | ethane;4-methyl-2-(oxan-2-yl)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-one |
|---|---|
| PubChem CID | 143126998 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethane;4-methyl-2-(oxan-2-yl)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridazin-3-one |
| SMILES | CC.Cc1c(C#Cc2ccc(C(F)(F)F)cc2)cnn(C2CCCCO2)c1=O |
| InChI | InChI=1S/C19H17F3N2O2.C2H6/c1-13-15(8-5-14-6-9-16(10-7-14)19(20,21)22)12-23-24(18(13)25)17-4-2-3-11-26-17;1-2/h6-7,9-10,12,17H,2-4,11H2,1H3;1-2H3 |
| InChIKey | NXVJLYSSUDDYRN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|