C25H36N2O3S — CID 143127376
3-[[4-[4-(cyclohexylmethoxy)phenyl]-1,3-thiazol-2-yl]-hexylamino]propanoic acid (PubChem CID 143127376) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is 3-[[4-[4-(cyclohexylmethoxy)phenyl]-1,3-thiazol-2-yl]-hexylamino]propanoic acid.
| Compound Name | 3-[[4-[4-(cyclohexylmethoxy)phenyl]-1,3-thiazol-2-yl]-hexylamino]propanoic acid |
|---|---|
| PubChem CID | 143127376 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 3-[[4-[4-(cyclohexylmethoxy)phenyl]-1,3-thiazol-2-yl]-hexylamino]propanoic acid |
| SMILES | CCCCCCN(CCC(=O)O)c1nc(-c2ccc(OCC3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C25H36N2O3S/c1-2-3-4-8-16-27(17-15-24(28)29)25-26-23(19-31-25)21-11-13-22(14-12-21)30-18-20-9-6-5-7-10-20/h11-14,19-20H,2-10,15-18H2,1H3,(H,28,29) |
| InChIKey | NYKLQDULRZQGTB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|