C27H31F3N2O4S — CID 154458460
2-[2-methyl-4-[2-[pentyl-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]ethoxy]phenoxy]propanoic acid (PubChem CID 154458460) has the molecular formula C27H31F3N2O4S and a molecular weight of 536.62 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-[pentyl-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]ethoxy]phenoxy]propanoic acid.
| Compound Name | 2-[2-methyl-4-[2-[pentyl-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]ethoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 154458460 |
| Molecular Formula | C27H31F3N2O4S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[2-methyl-4-[2-[pentyl-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]ethoxy]phenoxy]propanoic acid |
| SMILES | CCCCCN(CCOc1ccc(OC(C)C(=O)O)c(C)c1)c1nc(-c2ccc(C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C27H31F3N2O4S/c1-4-5-6-13-32(14-15-35-22-11-12-24(18(2)16-22)36-19(3)25(33)34)26-31-23(17-37-26)20-7-9-21(10-8-20)27(28,29)30/h7-12,16-17,19H,4-6,13-15H2,1-3H3,(H,33,34) |
| InChIKey | RRUVWTACNLKMLR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|