C12H22O2 — CID 143128038
2,4-dimethyl-4-(3-methylbutoxy)pent-1-en-3-one (PubChem CID 143128038) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,4-dimethyl-4-(3-methylbutoxy)pent-1-en-3-one.
| Compound Name | 2,4-dimethyl-4-(3-methylbutoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 143128038 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,4-dimethyl-4-(3-methylbutoxy)pent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)OCCC(C)C |
| InChI | InChI=1S/C12H22O2/c1-9(2)7-8-14-12(5,6)11(13)10(3)4/h9H,3,7-8H2,1-2,4-6H3 |
| InChIKey | PUDJGNJJYILVNH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|