C18H23ClO3 — CID 143128243
2-[2-(4-chlorophenoxy)ethyl]-4-(cyclohexen-1-yl)butanoic acid (PubChem CID 143128243) has the molecular formula C18H23ClO3 and a molecular weight of 322.83 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethyl]-4-(cyclohexen-1-yl)butanoic acid.
| Compound Name | 2-[2-(4-chlorophenoxy)ethyl]-4-(cyclohexen-1-yl)butanoic acid |
|---|---|
| PubChem CID | 143128243 |
| Molecular Formula | C18H23ClO3 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethyl]-4-(cyclohexen-1-yl)butanoic acid |
| SMILES | O=C(O)C(CCOc1ccc(Cl)cc1)CCC1=CCCCC1 |
| InChI | InChI=1S/C18H23ClO3/c19-16-8-10-17(11-9-16)22-13-12-15(18(20)21)7-6-14-4-2-1-3-5-14/h4,8-11,15H,1-3,5-7,12-13H2,(H,20,21) |
| InChIKey | OUADPOYLSBZKPR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|