C13H10ClFN4O3S — CID 143129052
2-(carbamoylamino)-5-[(3-chloro-2-fluorobenzoyl)amino]thiophene-3-carboxamide (PubChem CID 143129052) has the molecular formula C13H10ClFN4O3S and a molecular weight of 356.77 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[(3-chloro-2-fluorobenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[(3-chloro-2-fluorobenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 143129052 |
| Molecular Formula | C13H10ClFN4O3S |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(carbamoylamino)-5-[(3-chloro-2-fluorobenzoyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(NC(=O)c2cccc(Cl)c2F)cc1C(N)=O |
| InChI | InChI=1S/C13H10ClFN4O3S/c14-7-3-1-2-5(9(7)15)11(21)18-8-4-6(10(16)20)12(23-8)19-13(17)22/h1-4H,(H2,16,20)(H,18,21)(H3,17,19,22) |
| InChIKey | LLCLLJJEBGXYKA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |