C13H18N4O3S — CID 143129001
2-(carbamoylamino)-5-(cyclohexanecarbonylamino)thiophene-3-carboxamide (PubChem CID 143129001) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(cyclohexanecarbonylamino)thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-(cyclohexanecarbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 143129001 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(carbamoylamino)-5-(cyclohexanecarbonylamino)thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(NC(=O)C2CCCCC2)cc1C(N)=O |
| InChI | InChI=1S/C13H18N4O3S/c14-10(18)8-6-9(21-12(8)17-13(15)20)16-11(19)7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,14,18)(H,16,19)(H3,15,17,20) |
| InChIKey | IGIBMTFNZVQAAP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |