C11H11N3O2S — CID 25137997
2-(carbamoylamino)-5-(2-cyclopropylethynyl)thiophene-3-carboxamide (PubChem CID 25137997) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(2-cyclopropylethynyl)thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-(2-cyclopropylethynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 25137997 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(carbamoylamino)-5-(2-cyclopropylethynyl)thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(C#CC2CC2)cc1C(N)=O |
| InChI | InChI=1S/C11H11N3O2S/c12-9(15)8-5-7(4-3-6-1-2-6)17-10(8)14-11(13)16/h5-6H,1-2H2,(H2,12,15)(H3,13,14,16) |
| InChIKey | KMOKNYYFGYTOIL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|