C15H12N2O4S — CID 91367020
2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxylic acid (PubChem CID 91367020) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxylic acid.
| Compound Name | 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 91367020 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxylic acid |
| SMILES | COc1ccc(C#Cc2cc(C(=O)O)c(NC(N)=O)s2)cc1 |
| InChI | InChI=1S/C15H12N2O4S/c1-21-10-5-2-9(3-6-10)4-7-11-8-12(14(18)19)13(22-11)17-15(16)20/h2-3,5-6,8H,1H3,(H,18,19)(H3,16,17,20) |
| InChIKey | RDMSCGPDXNQPIU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|